C19H17FN2O5S — CID 55489283
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 55489283) has the molecular formula C19H17FN2O5S and a molecular weight of 404.42 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55489283 |
| Molecular Formula | C19H17FN2O5S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)OCC(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C19H17FN2O5S/c1-2-11-22-28(25,26)16-9-7-14(8-10-16)19(24)27-13-18(23)21-12-15-5-3-4-6-17(15)20/h1,3-10,22H,11-13H2,(H,21,23) |
| InChIKey | RZLMYCZBOKCBED-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|