C19H17FN2O5S — CID 8644584
[2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-(cyanomethylsulfonylmethyl)benzoate (PubChem CID 8644584) has the molecular formula C19H17FN2O5S and a molecular weight of 404.42 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-(cyanomethylsulfonylmethyl)benzoate.
| Compound Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-(cyanomethylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 8644584 |
| Molecular Formula | C19H17FN2O5S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]-2-oxoethyl] 4-(cyanomethylsulfonylmethyl)benzoate |
| SMILES | N#CCS(=O)(=O)Cc1ccc(C(=O)OCC(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C19H17FN2O5S/c20-17-4-2-1-3-16(17)11-22-18(23)12-27-19(24)15-7-5-14(6-8-15)13-28(25,26)10-9-21/h1-8H,10-13H2,(H,22,23) |
| InChIKey | BYSSJEYJFPUKCA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |