C20H18N2O5S — CID 8837154
naphthalen-1-ylmethyl 4-[(2-amino-2-oxoethyl)sulfamoyl]benzoate (PubChem CID 8837154) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 4-[(2-amino-2-oxoethyl)sulfamoyl]benzoate.
| Compound Name | naphthalen-1-ylmethyl 4-[(2-amino-2-oxoethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8837154 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | naphthalen-1-ylmethyl 4-[(2-amino-2-oxoethyl)sulfamoyl]benzoate |
| SMILES | NC(=O)CNS(=O)(=O)c1ccc(C(=O)OCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C20H18N2O5S/c21-19(23)12-22-28(25,26)17-10-8-15(9-11-17)20(24)27-13-16-6-3-5-14-4-1-2-7-18(14)16/h1-11,22H,12-13H2,(H2,21,23) |
| InChIKey | DPELHQGULGRRSD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |