C17H17ClN2O6S — CID 8837159
2-(4-chlorophenoxy)ethyl 4-[(2-amino-2-oxoethyl)sulfamoyl]benzoate (PubChem CID 8837159) has the molecular formula C17H17ClN2O6S and a molecular weight of 412.85 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 4-[(2-amino-2-oxoethyl)sulfamoyl]benzoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 4-[(2-amino-2-oxoethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8837159 |
| Molecular Formula | C17H17ClN2O6S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 4-[(2-amino-2-oxoethyl)sulfamoyl]benzoate |
| SMILES | NC(=O)CNS(=O)(=O)c1ccc(C(=O)OCCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H17ClN2O6S/c18-13-3-5-14(6-4-13)25-9-10-26-17(22)12-1-7-15(8-2-12)27(23,24)20-11-16(19)21/h1-8,20H,9-11H2,(H2,19,21) |
| InChIKey | GRGYHCOAMQDXEF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|