C22H21NO4S2 — CID 11597106
S-[2-[4-(2-naphthalen-1-ylethylsulfamoyl)phenyl]-2-oxoethyl] ethanethioate (PubChem CID 11597106) has the molecular formula C22H21NO4S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is S-[2-[4-(2-naphthalen-1-ylethylsulfamoyl)phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-(2-naphthalen-1-ylethylsulfamoyl)phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11597106 |
| Molecular Formula | C22H21NO4S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | S-[2-[4-(2-naphthalen-1-ylethylsulfamoyl)phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(S(=O)(=O)NCCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H21NO4S2/c1-16(24)28-15-22(25)19-9-11-20(12-10-19)29(26,27)23-14-13-18-7-4-6-17-5-2-3-8-21(17)18/h2-12,23H,13-15H2,1H3 |
| InChIKey | MKAUTXFKGXXSAN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|