C18H15NO4S3 — CID 11718384
S-[2-[4-(1-benzothiophen-3-ylsulfonylamino)phenyl]-2-oxoethyl] ethanethioate (PubChem CID 11718384) has the molecular formula C18H15NO4S3 and a molecular weight of 405.52 g/mol. Its IUPAC name is S-[2-[4-(1-benzothiophen-3-ylsulfonylamino)phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-(1-benzothiophen-3-ylsulfonylamino)phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11718384 |
| Molecular Formula | C18H15NO4S3 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | S-[2-[4-(1-benzothiophen-3-ylsulfonylamino)phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2csc3ccccc23)cc1 |
| InChI | InChI=1S/C18H15NO4S3/c1-12(20)24-10-16(21)13-6-8-14(9-7-13)19-26(22,23)18-11-25-17-5-3-2-4-15(17)18/h2-9,11,19H,10H2,1H3 |
| InChIKey | PSUMEHUPHDJQOL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|