C15H17N3O4S2 — CID 11559682
S-[2-[4-[(1,2-dimethylimidazol-4-yl)sulfonylamino]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 11559682) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is S-[2-[4-[(1,2-dimethylimidazol-4-yl)sulfonylamino]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[(1,2-dimethylimidazol-4-yl)sulfonylamino]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11559682 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | S-[2-[4-[(1,2-dimethylimidazol-4-yl)sulfonylamino]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2cn(C)c(C)n2)cc1 |
| InChI | InChI=1S/C15H17N3O4S2/c1-10-16-15(8-18(10)3)24(21,22)17-13-6-4-12(5-7-13)14(20)9-23-11(2)19/h4-8,17H,9H2,1-3H3 |
| InChIKey | YEEIAJYMZMWZQX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|