C23H20INO4S2 — CID 89220456
S-[2-[4-[[4-(3-iodo-5-methylphenyl)phenyl]sulfonylamino]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 89220456) has the molecular formula C23H20INO4S2 and a molecular weight of 565.45 g/mol. Its IUPAC name is S-[2-[4-[[4-(3-iodo-5-methylphenyl)phenyl]sulfonylamino]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[[4-(3-iodo-5-methylphenyl)phenyl]sulfonylamino]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 89220456 |
| Molecular Formula | C23H20INO4S2 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 564.99 |
| IUPAC Name | S-[2-[4-[[4-(3-iodo-5-methylphenyl)phenyl]sulfonylamino]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2ccc(-c3cc(C)cc(I)c3)cc2)cc1 |
| InChI | InChI=1S/C23H20INO4S2/c1-15-11-19(13-20(24)12-15)17-5-9-22(10-6-17)31(28,29)25-21-7-3-18(4-8-21)23(27)14-30-16(2)26/h3-13,25H,14H2,1-2H3 |
| InChIKey | LCHJQKWDLAMTJV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|