C20H18F3NO4S2 — CID 11547054
S-[2-oxo-2-[4-[[3-(trifluoromethyl)-2,3-dihydro-1H-inden-5-yl]sulfonylamino]phenyl]ethyl] ethanethioate (PubChem CID 11547054) has the molecular formula C20H18F3NO4S2 and a molecular weight of 457.50 g/mol. Its IUPAC name is S-[2-oxo-2-[4-[[3-(trifluoromethyl)-2,3-dihydro-1H-inden-5-yl]sulfonylamino]phenyl]ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-[4-[[3-(trifluoromethyl)-2,3-dihydro-1H-inden-5-yl]sulfonylamino]phenyl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 11547054 |
| Molecular Formula | C20H18F3NO4S2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | S-[2-oxo-2-[4-[[3-(trifluoromethyl)-2,3-dihydro-1H-inden-5-yl]sulfonylamino]phenyl]ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)C(C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C20H18F3NO4S2/c1-12(25)29-11-19(26)14-2-6-15(7-3-14)24-30(27,28)16-8-4-13-5-9-18(17(13)10-16)20(21,22)23/h2-4,6-8,10,18,24H,5,9,11H2,1H3 |
| InChIKey | LPWCOOONXNZALV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|