C20H15F3N2O4S3 — CID 58599173
S-[2-oxo-2-[4-[[6-[4-(trifluoromethyl)thiophen-3-yl]-3-pyridinyl]sulfamoyl]phenyl]ethyl] ethanethioate (PubChem CID 58599173) has the molecular formula C20H15F3N2O4S3 and a molecular weight of 500.55 g/mol. Its IUPAC name is S-[2-oxo-2-[4-[[6-[4-(trifluoromethyl)thiophen-3-yl]-3-pyridinyl]sulfamoyl]phenyl]ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-[4-[[6-[4-(trifluoromethyl)thiophen-3-yl]-3-pyridinyl]sulfamoyl]phenyl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 58599173 |
| Molecular Formula | C20H15F3N2O4S3 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | S-[2-oxo-2-[4-[[6-[4-(trifluoromethyl)thiophen-3-yl]-3-pyridinyl]sulfamoyl]phenyl]ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(S(=O)(=O)Nc2ccc(-c3cscc3C(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C20H15F3N2O4S3/c1-12(26)31-11-19(27)13-2-5-15(6-3-13)32(28,29)25-14-4-7-18(24-8-14)16-9-30-10-17(16)20(21,22)23/h2-10,25H,11H2,1H3 |
| InChIKey | JCISJXDMCBKXOY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|