C19H17F3N2O7S2 — CID 11341124
3-amino-4-oxo-4-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]sulfanylbutanoic acid (PubChem CID 11341124) has the molecular formula C19H17F3N2O7S2 and a molecular weight of 506.48 g/mol. Its IUPAC name is 3-amino-4-oxo-4-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]sulfanylbutanoic acid.
| Compound Name | 3-amino-4-oxo-4-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 11341124 |
| Molecular Formula | C19H17F3N2O7S2 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | 3-amino-4-oxo-4-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]sulfanylbutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)SCC(=O)c1ccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H17F3N2O7S2/c20-19(21,22)31-13-5-7-14(8-6-13)33(29,30)24-12-3-1-11(2-4-12)16(25)10-32-18(28)15(23)9-17(26)27/h1-8,15,24H,9-10,23H2,(H,26,27) |
| InChIKey | XDEXHWSFVJNMNF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|