C17H14F3NO5S2 — CID 11697747
S-[2-oxo-2-[2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl] ethanethioate (PubChem CID 11697747) has the molecular formula C17H14F3NO5S2 and a molecular weight of 433.43 g/mol. Its IUPAC name is S-[2-oxo-2-[2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-[2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 11697747 |
| Molecular Formula | C17H14F3NO5S2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | S-[2-oxo-2-[2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccccc1NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO5S2/c1-11(22)27-10-16(23)14-4-2-3-5-15(14)21-28(24,25)13-8-6-12(7-9-13)26-17(18,19)20/h2-9,21H,10H2,1H3 |
| InChIKey | ZBIZEDHLYGATIR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|