C32H27F6NO8S — CID 91366756
bis(prop-2-enyl) 2-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]-2-[[4-(trifluoromethyl)phenyl]methyl]propanedioate (PubChem CID 91366756) has the molecular formula C32H27F6NO8S and a molecular weight of 699.62 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]-2-[[4-(trifluoromethyl)phenyl]methyl]propanedioate.
| Compound Name | bis(prop-2-enyl) 2-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]-2-[[4-(trifluoromethyl)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 91366756 |
| Molecular Formula | C32H27F6NO8S |
| Molecular Weight | 699.62 g/mol |
| Exact Mass | 699.14 |
| IUPAC Name | bis(prop-2-enyl) 2-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]-2-[[4-(trifluoromethyl)phenyl]methyl]propanedioate |
| SMILES | C=CCOC(=O)C(CC(=O)c1ccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1)(Cc1ccc(C(F)(F)F)cc1)C(=O)OCC=C |
| InChI | InChI=1S/C32H27F6NO8S/c1-3-17-45-28(41)30(29(42)46-18-4-2,19-21-5-9-23(10-6-21)31(33,34)35)20-27(40)22-7-11-24(12-8-22)39-48(43,44)26-15-13-25(14-16-26)47-32(36,37)38/h3-16,39H,1-2,17-20H2 |
| InChIKey | HHOGBQZUDJMAML-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|