C29H28N2O8S — CID 89301799
bis(prop-2-enyl) 2-[2-[4-[(4-hydroxyphenyl)sulfonylamino]phenyl]-2-oxoethyl]-2-(pyridin-3-ylmethyl)propanedioate (PubChem CID 89301799) has the molecular formula C29H28N2O8S and a molecular weight of 564.62 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[2-[4-[(4-hydroxyphenyl)sulfonylamino]phenyl]-2-oxoethyl]-2-(pyridin-3-ylmethyl)propanedioate.
| Compound Name | bis(prop-2-enyl) 2-[2-[4-[(4-hydroxyphenyl)sulfonylamino]phenyl]-2-oxoethyl]-2-(pyridin-3-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 89301799 |
| Molecular Formula | C29H28N2O8S |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | bis(prop-2-enyl) 2-[2-[4-[(4-hydroxyphenyl)sulfonylamino]phenyl]-2-oxoethyl]-2-(pyridin-3-ylmethyl)propanedioate |
| SMILES | C=CCOC(=O)C(CC(=O)c1ccc(NS(=O)(=O)c2ccc(O)cc2)cc1)(Cc1cccnc1)C(=O)OCC=C |
| InChI | InChI=1S/C29H28N2O8S/c1-3-16-38-27(34)29(28(35)39-17-4-2,18-21-6-5-15-30-20-21)19-26(33)22-7-9-23(10-8-22)31-40(36,37)25-13-11-24(32)12-14-25/h3-15,20,31-32H,1-2,16-19H2 |
| InChIKey | XAJCMYRWQARQJL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|