About S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate
S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate (PubChem CID 11712388) has the molecular formula C22H16N4O4S2
and a molecular weight of 464.53 g/mol. Its IUPAC name is S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate.
Molecular Properties
| Compound Name | S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate |
| PubChem CID | 11712388 |
| Molecular Formula | C22H16N4O4S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate |
| SMILES | O=C(CSC(=O)c1cccnc1)c1ccc(NS(=O)(=O)c2ccc3nccnc3c2)cc1 |
| InChI | InChI=1S/C22H16N4O4S2/c27-21(14-31-22(28)16-2-1-9-23-13-16)15-3-5-17(6-4-15)26-32(29,30)18-7-8-19-20(12-18)25-11-10-24-19/h1-13,26H,14H2 |
| InChIKey | QUWZUDDLIYICKA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate?
The IUPAC name of S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate (CID 11712388) is S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate.
What is the SMILES notation for S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate?
The canonical SMILES for S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate is O=C(CSC(=O)c1cccnc1)c1ccc(NS(=O)(=O)c2ccc3nccnc3c2)cc1.
What is the InChIKey of S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate?
The InChIKey is QUWZUDDLIYICKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O4S2/c27-21(14-31-22(28)16-2-1-9-23-13-16)15-3-5-17(6-4-15)26-32(29,30)18-7-8-19-20(12-18)25-11-10-24-19/h1-13,26H,14H2.
What are the key properties of S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate?
S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate has a molecular weight of 464.53 g/mol, XLogP of 3.58, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-oxo-2-[4-(quinoxalin-6-ylsulfonylamino)phenyl]ethyl] pyridine-3-carbothioate is sourced from PubChem (CID 11712388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).