C16H14FNO4S2 — CID 11689172
S-[2-[4-[(3-fluorophenyl)sulfamoyl]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 11689172) has the molecular formula C16H14FNO4S2 and a molecular weight of 367.42 g/mol. Its IUPAC name is S-[2-[4-[(3-fluorophenyl)sulfamoyl]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[(3-fluorophenyl)sulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11689172 |
| Molecular Formula | C16H14FNO4S2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | S-[2-[4-[(3-fluorophenyl)sulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(S(=O)(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C16H14FNO4S2/c1-11(19)23-10-16(20)12-5-7-15(8-6-12)24(21,22)18-14-4-2-3-13(17)9-14/h2-9,18H,10H2,1H3 |
| InChIKey | KAEWSZSVNUEEPR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|