C20H17NO4S3 — CID 58599182
S-[2-oxo-2-[4-[(4-thiophen-2-ylphenyl)sulfonylamino]phenyl]ethyl] ethanethioate (PubChem CID 58599182) has the molecular formula C20H17NO4S3 and a molecular weight of 431.56 g/mol. Its IUPAC name is S-[2-oxo-2-[4-[(4-thiophen-2-ylphenyl)sulfonylamino]phenyl]ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-[4-[(4-thiophen-2-ylphenyl)sulfonylamino]phenyl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 58599182 |
| Molecular Formula | C20H17NO4S3 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | S-[2-oxo-2-[4-[(4-thiophen-2-ylphenyl)sulfonylamino]phenyl]ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2ccc(-c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C20H17NO4S3/c1-14(22)27-13-19(23)15-4-8-17(9-5-15)21-28(24,25)18-10-6-16(7-11-18)20-3-2-12-26-20/h2-12,21H,13H2,1H3 |
| InChIKey | BCQFZXSBEXEJHI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|