C17H16FNO4S2 — CID 11603343
S-[2-[4-[(4-fluoro-3-methylphenyl)sulfamoyl]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 11603343) has the molecular formula C17H16FNO4S2 and a molecular weight of 381.45 g/mol. Its IUPAC name is S-[2-[4-[(4-fluoro-3-methylphenyl)sulfamoyl]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[(4-fluoro-3-methylphenyl)sulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11603343 |
| Molecular Formula | C17H16FNO4S2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | S-[2-[4-[(4-fluoro-3-methylphenyl)sulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(S(=O)(=O)Nc2ccc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C17H16FNO4S2/c1-11-9-14(5-8-16(11)18)19-25(22,23)15-6-3-13(4-7-15)17(21)10-24-12(2)20/h3-9,19H,10H2,1-2H3 |
| InChIKey | VQXWNGAGYJGBBH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|