C14H13FN2O2S2 — CID 62812698
4-[(4-fluoro-3-methylphenyl)sulfamoyl]benzenecarbothioamide (PubChem CID 62812698) has the molecular formula C14H13FN2O2S2 and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-[(4-fluoro-3-methylphenyl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 4-[(4-fluoro-3-methylphenyl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 62812698 |
| Molecular Formula | C14H13FN2O2S2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-[(4-fluoro-3-methylphenyl)sulfamoyl]benzenecarbothioamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(C(N)=S)cc2)ccc1F |
| InChI | InChI=1S/C14H13FN2O2S2/c1-9-8-11(4-7-13(9)15)17-21(18,19)12-5-2-10(3-6-12)14(16)20/h2-8,17H,1H3,(H2,16,20) |
| InChIKey | IYZHAKWULVJLNK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|