C14H13N3O4S2 — CID 11624484
S-[2-oxo-2-[4-(pyrimidin-5-ylsulfonylamino)phenyl]ethyl] ethanethioate (PubChem CID 11624484) has the molecular formula C14H13N3O4S2 and a molecular weight of 351.41 g/mol. Its IUPAC name is S-[2-oxo-2-[4-(pyrimidin-5-ylsulfonylamino)phenyl]ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-[4-(pyrimidin-5-ylsulfonylamino)phenyl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 11624484 |
| Molecular Formula | C14H13N3O4S2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | S-[2-oxo-2-[4-(pyrimidin-5-ylsulfonylamino)phenyl]ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2cncnc2)cc1 |
| InChI | InChI=1S/C14H13N3O4S2/c1-10(18)22-8-14(19)11-2-4-12(5-3-11)17-23(20,21)13-6-15-9-16-7-13/h2-7,9,17H,8H2,1H3 |
| InChIKey | YCBCSZBQRKPJJC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|