C13H12N2O4S3 — CID 11210494
S-[2-oxo-2-[4-(1,3-thiazol-2-ylsulfonylamino)phenyl]ethyl] ethanethioate (PubChem CID 11210494) has the molecular formula C13H12N2O4S3 and a molecular weight of 356.45 g/mol. Its IUPAC name is S-[2-oxo-2-[4-(1,3-thiazol-2-ylsulfonylamino)phenyl]ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-[4-(1,3-thiazol-2-ylsulfonylamino)phenyl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 11210494 |
| Molecular Formula | C13H12N2O4S3 |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | S-[2-oxo-2-[4-(1,3-thiazol-2-ylsulfonylamino)phenyl]ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NS(=O)(=O)c2nccs2)cc1 |
| InChI | InChI=1S/C13H12N2O4S3/c1-9(16)21-8-12(17)10-2-4-11(5-3-10)15-22(18,19)13-14-6-7-20-13/h2-7,15H,8H2,1H3 |
| InChIKey | NPMSQEVMOGUUNM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|