C17H17NO4 — CID 91682612
prop-2-enyl 3-methoxy-4-(pyridin-3-ylmethoxy)benzoate (PubChem CID 91682612) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is prop-2-enyl 3-methoxy-4-(pyridin-3-ylmethoxy)benzoate.
| Compound Name | prop-2-enyl 3-methoxy-4-(pyridin-3-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 91682612 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | prop-2-enyl 3-methoxy-4-(pyridin-3-ylmethoxy)benzoate |
| SMILES | C=CCOC(=O)c1ccc(OCc2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C17H17NO4/c1-3-9-21-17(19)14-6-7-15(16(10-14)20-2)22-12-13-5-4-8-18-11-13/h3-8,10-11H,1,9,12H2,2H3 |
| InChIKey | UHVPVAPSAVDCPD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|