C22H19BrN4O3S — CID 134013413
4-[(4-bromophenyl)sulfonylamino]-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 134013413) has the molecular formula C22H19BrN4O3S and a molecular weight of 499.39 g/mol. Its IUPAC name is 4-[(4-bromophenyl)sulfonylamino]-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[(4-bromophenyl)sulfonylamino]-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 134013413 |
| Molecular Formula | C22H19BrN4O3S |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 4-[(4-bromophenyl)sulfonylamino]-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | N#CCCN(Cc1cccnc1)C(=O)c1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H19BrN4O3S/c23-19-6-10-21(11-7-19)31(29,30)26-20-8-4-18(5-9-20)22(28)27(14-2-12-24)16-17-3-1-13-25-15-17/h1,3-11,13,15,26H,2,14,16H2 |
| InChIKey | KHCZTLZMNDUDTQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |