C33H43F3N4O5S — CID 158211514
N-[1-(4-aminophenyl)-2-methylpropan-2-yl]propanamide;N-[2-methyl-1-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]propan-2-yl]propanamide (PubChem CID 158211514) has the molecular formula C33H43F3N4O5S and a molecular weight of 664.79 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)-2-methylpropan-2-yl]propanamide;N-[2-methyl-1-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]propan-2-yl]propanamide.
| Compound Name | N-[1-(4-aminophenyl)-2-methylpropan-2-yl]propanamide;N-[2-methyl-1-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]propan-2-yl]propanamide |
|---|---|
| PubChem CID | 158211514 |
| Molecular Formula | C33H43F3N4O5S |
| Molecular Weight | 664.79 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | N-[1-(4-aminophenyl)-2-methylpropan-2-yl]propanamide;N-[2-methyl-1-[4-[[4-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]propan-2-yl]propanamide |
| SMILES | CCC(=O)NC(C)(C)Cc1ccc(N)cc1.CCC(=O)NC(C)(C)Cc1ccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H23F3N2O4S.C13H20N2O/c1-4-18(26)24-19(2,3)13-14-5-7-15(8-6-14)25-30(27,28)17-11-9-16(10-12-17)29-20(21,22)23;1-4-12(16)15-13(2,3)9-10-5-7-11(14)8-6-10/h5-12,25H,4,13H2,1-3H3,(H,24,26);5-8H,4,9,14H2,1-3H3,(H,15,16) |
| InChIKey | GCDFDZXIPAZFPC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.79 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|