C21H28N2O6S — CID 153396368
2-[3-[4-[(4-aminophenyl)sulfonylamino]phenoxy]-3-methylbutoxy]-2-methylpropanoic acid (PubChem CID 153396368) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-[3-[4-[(4-aminophenyl)sulfonylamino]phenoxy]-3-methylbutoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[4-[(4-aminophenyl)sulfonylamino]phenoxy]-3-methylbutoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 153396368 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[3-[4-[(4-aminophenyl)sulfonylamino]phenoxy]-3-methylbutoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(CCOC(C)(C)C(=O)O)Oc1ccc(NS(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O6S/c1-20(2,13-14-28-21(3,4)19(24)25)29-17-9-7-16(8-10-17)23-30(26,27)18-11-5-15(22)6-12-18/h5-12,23H,13-14,22H2,1-4H3,(H,24,25) |
| InChIKey | WCMMAHYSEQXSED-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|