C19H21NO6S2 — CID 59779098
S-[2-[4-[2-(2-hydroxy-5-methoxyphenyl)ethylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 59779098) has the molecular formula C19H21NO6S2 and a molecular weight of 423.51 g/mol. Its IUPAC name is S-[2-[4-[2-(2-hydroxy-5-methoxyphenyl)ethylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[2-(2-hydroxy-5-methoxyphenyl)ethylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 59779098 |
| Molecular Formula | C19H21NO6S2 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | S-[2-[4-[2-(2-hydroxy-5-methoxyphenyl)ethylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | COc1ccc(O)c(CCNS(=O)(=O)c2ccc(C(=O)CSC(C)=O)cc2)c1 |
| InChI | InChI=1S/C19H21NO6S2/c1-13(21)27-12-19(23)14-3-6-17(7-4-14)28(24,25)20-10-9-15-11-16(26-2)5-8-18(15)22/h3-8,11,20,22H,9-10,12H2,1-2H3 |
| InChIKey | DQSVDFTUQIITSV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|