C22H20ClNO4S2 — CID 11583481
S-[2-[4-[2-(6-chloronaphthalen-2-yl)ethylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 11583481) has the molecular formula C22H20ClNO4S2 and a molecular weight of 461.99 g/mol. Its IUPAC name is S-[2-[4-[2-(6-chloronaphthalen-2-yl)ethylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[2-(6-chloronaphthalen-2-yl)ethylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11583481 |
| Molecular Formula | C22H20ClNO4S2 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | S-[2-[4-[2-(6-chloronaphthalen-2-yl)ethylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(S(=O)(=O)NCCc2ccc3cc(Cl)ccc3c2)cc1 |
| InChI | InChI=1S/C22H20ClNO4S2/c1-15(25)29-14-22(26)17-5-8-21(9-6-17)30(27,28)24-11-10-16-2-3-19-13-20(23)7-4-18(19)12-16/h2-9,12-13,24H,10-11,14H2,1H3 |
| InChIKey | PPVPTMORXAPSRI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|