C20H20FNO2S — CID 100696895
4-fluoro-3-methyl-N-(3-naphthalen-1-ylpropyl)benzenesulfonamide (PubChem CID 100696895) has the molecular formula C20H20FNO2S and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-(3-naphthalen-1-ylpropyl)benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-(3-naphthalen-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100696895 |
| Molecular Formula | C20H20FNO2S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-fluoro-3-methyl-N-(3-naphthalen-1-ylpropyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCc2cccc3ccccc23)ccc1F |
| InChI | InChI=1S/C20H20FNO2S/c1-15-14-18(11-12-20(15)21)25(23,24)22-13-5-9-17-8-4-7-16-6-2-3-10-19(16)17/h2-4,6-8,10-12,14,22H,5,9,13H2,1H3 |
| InChIKey | FUUPPCUEGBFHPQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|