C13H16FN3O5S2 — CID 9188814
4-fluoro-3-methyl-N-[3-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]benzenesulfonamide (PubChem CID 9188814) has the molecular formula C13H16FN3O5S2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[3-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[3-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9188814 |
| Molecular Formula | C13H16FN3O5S2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 4-fluoro-3-methyl-N-[3-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCc2nnc(S(C)(=O)=O)o2)ccc1F |
| InChI | InChI=1S/C13H16FN3O5S2/c1-9-8-10(5-6-11(9)14)24(20,21)15-7-3-4-12-16-17-13(22-12)23(2,18)19/h5-6,8,15H,3-4,7H2,1-2H3 |
| InChIKey | ZAFNWDSAGSGWNT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|