C15H21N3O5S2 — CID 9189000
4-methyl-N-[5-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pentyl]benzenesulfonamide (PubChem CID 9189000) has the molecular formula C15H21N3O5S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-methyl-N-[5-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pentyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[5-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9189000 |
| Molecular Formula | C15H21N3O5S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-methyl-N-[5-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pentyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCCc2nnc(S(C)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C15H21N3O5S2/c1-12-7-9-13(10-8-12)25(21,22)16-11-5-3-4-6-14-17-18-15(23-14)24(2,19)20/h7-10,16H,3-6,11H2,1-2H3 |
| InChIKey | RRYCUMYBLFMKEJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|