C16H21N3O4S — CID 9189117
N-[5-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pentyl]-2-phenylacetamide (PubChem CID 9189117) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[5-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pentyl]-2-phenylacetamide.
| Compound Name | N-[5-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pentyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 9189117 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[5-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)pentyl]-2-phenylacetamide |
| SMILES | CS(=O)(=O)c1nnc(CCCCCNC(=O)Cc2ccccc2)o1 |
| InChI | InChI=1S/C16H21N3O4S/c1-24(21,22)16-19-18-15(23-16)10-6-3-7-11-17-14(20)12-13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-12H2,1H3,(H,17,20) |
| InChIKey | IRJRJMZHYXGKJJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|