C9H14ClN3O4S — CID 9188869
3-chloro-N-[3-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]propanamide (PubChem CID 9188869) has the molecular formula C9H14ClN3O4S and a molecular weight of 295.75 g/mol. Its IUPAC name is 3-chloro-N-[3-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]propanamide.
| Compound Name | 3-chloro-N-[3-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 9188869 |
| Molecular Formula | C9H14ClN3O4S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-chloro-N-[3-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)propyl]propanamide |
| SMILES | CS(=O)(=O)c1nnc(CCCNC(=O)CCCl)o1 |
| InChI | InChI=1S/C9H14ClN3O4S/c1-18(15,16)9-13-12-8(17-9)3-2-6-11-7(14)4-5-10/h2-6H2,1H3,(H,11,14) |
| InChIKey | LRYJIQOIIVBAPB-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|