C17H15ClFNO4S — CID 7973883
(2-chloro-6-fluorophenyl)methyl 3-(prop-2-enylsulfamoyl)benzoate (PubChem CID 7973883) has the molecular formula C17H15ClFNO4S and a molecular weight of 383.83 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 3-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 3-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7973883 |
| Molecular Formula | C17H15ClFNO4S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 3-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)OCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C17H15ClFNO4S/c1-2-9-20-25(22,23)13-6-3-5-12(10-13)17(21)24-11-14-15(18)7-4-8-16(14)19/h2-8,10,20H,1,9,11H2 |
| InChIKey | DOAABOBODAJYLK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|