About (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate
(2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate (PubChem CID 1293916) has the molecular formula C21H15ClFNO3
and a molecular weight of 383.81 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate.
Molecular Properties
| Compound Name | (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate |
| PubChem CID | 1293916 |
| Molecular Formula | C21H15ClFNO3 |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate |
| SMILES | O=C(Nc1ccc(C(=O)OCc2c(F)cccc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H15ClFNO3/c22-18-7-4-8-19(23)17(18)13-27-21(26)15-9-11-16(12-10-15)24-20(25)14-5-2-1-3-6-14/h1-12H,13H2,(H,24,25) |
| InChIKey | DXSQYKDPCLGLAT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate?
The IUPAC name of (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate (CID 1293916) is (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate.
What is the SMILES notation for (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate?
The canonical SMILES for (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate is O=C(Nc1ccc(C(=O)OCc2c(F)cccc2Cl)cc1)c1ccccc1.
What is the InChIKey of (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate?
The InChIKey is DXSQYKDPCLGLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClFNO3/c22-18-7-4-8-19(23)17(18)13-27-21(26)15-9-11-16(12-10-15)24-20(25)14-5-2-1-3-6-14/h1-12H,13H2,(H,24,25).
What are the key properties of (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate?
(2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate has a molecular weight of 383.81 g/mol, XLogP of 5.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-6-fluorophenyl)methyl 4-benzamidobenzoate is sourced from PubChem (CID 1293916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).