C17H17ClFNO4S — CID 55475796
(2-chloro-6-fluorophenyl)methyl 4-(propan-2-ylsulfamoyl)benzoate (PubChem CID 55475796) has the molecular formula C17H17ClFNO4S and a molecular weight of 385.84 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 4-(propan-2-ylsulfamoyl)benzoate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 4-(propan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55475796 |
| Molecular Formula | C17H17ClFNO4S |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 4-(propan-2-ylsulfamoyl)benzoate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)OCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H17ClFNO4S/c1-11(2)20-25(22,23)13-8-6-12(7-9-13)17(21)24-10-14-15(18)4-3-5-16(14)19/h3-9,11,20H,10H2,1-2H3 |
| InChIKey | VYUIXMIXSCDBPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |