C12H19N7O4S — CID 55701272
(1-butyltetrazol-5-yl)methyl 2-[(1-methylpyrazol-4-yl)sulfonylamino]acetate (PubChem CID 55701272) has the molecular formula C12H19N7O4S and a molecular weight of 357.40 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-[(1-methylpyrazol-4-yl)sulfonylamino]acetate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-[(1-methylpyrazol-4-yl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 55701272 |
| Molecular Formula | C12H19N7O4S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-[(1-methylpyrazol-4-yl)sulfonylamino]acetate |
| SMILES | CCCCn1nnnc1COC(=O)CNS(=O)(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C12H19N7O4S/c1-3-4-5-19-11(15-16-17-19)9-23-12(20)7-14-24(21,22)10-6-13-18(2)8-10/h6,8,14H,3-5,7,9H2,1-2H3 |
| InChIKey | RQYLGMCBUGWWOM-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |