C19H27N5O4S — CID 55390402
(1-butyltetrazol-5-yl)methyl 2-(4-piperidin-1-ylsulfonylphenyl)acetate (PubChem CID 55390402) has the molecular formula C19H27N5O4S and a molecular weight of 421.52 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-(4-piperidin-1-ylsulfonylphenyl)acetate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-(4-piperidin-1-ylsulfonylphenyl)acetate |
|---|---|
| PubChem CID | 55390402 |
| Molecular Formula | C19H27N5O4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-(4-piperidin-1-ylsulfonylphenyl)acetate |
| SMILES | CCCCn1nnnc1COC(=O)Cc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27N5O4S/c1-2-3-13-24-18(20-21-22-24)15-28-19(25)14-16-7-9-17(10-8-16)29(26,27)23-11-5-4-6-12-23/h7-10H,2-6,11-15H2,1H3 |
| InChIKey | WNBAWNKAQKCGCS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |