C13H16BrN5O4 — CID 7703282
(1-butyltetrazol-5-yl)methyl 2-[(5-bromofuran-2-carbonyl)amino]acetate (PubChem CID 7703282) has the molecular formula C13H16BrN5O4 and a molecular weight of 386.21 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-[(5-bromofuran-2-carbonyl)amino]acetate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-[(5-bromofuran-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 7703282 |
| Molecular Formula | C13H16BrN5O4 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-[(5-bromofuran-2-carbonyl)amino]acetate |
| SMILES | CCCCn1nnnc1COC(=O)CNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H16BrN5O4/c1-2-3-6-19-11(16-17-18-19)8-22-12(20)7-15-13(21)9-4-5-10(14)23-9/h4-5H,2-3,6-8H2,1H3,(H,15,21) |
| InChIKey | BEPOBGSJUDCOOA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |