C12H17N5O4S2 — CID 55624067
(1-butyltetrazol-5-yl)methyl 2-(thiophen-2-ylsulfonylamino)acetate (PubChem CID 55624067) has the molecular formula C12H17N5O4S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-(thiophen-2-ylsulfonylamino)acetate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-(thiophen-2-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 55624067 |
| Molecular Formula | C12H17N5O4S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-(thiophen-2-ylsulfonylamino)acetate |
| SMILES | CCCCn1nnnc1COC(=O)CNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H17N5O4S2/c1-2-3-6-17-10(14-15-16-17)9-21-11(18)8-13-23(19,20)12-5-4-7-22-12/h4-5,7,13H,2-3,6,8-9H2,1H3 |
| InChIKey | VOKUGYDHIQOZPT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |