C16H20F3N3O6S — CID 55420502
[2-(butylcarbamoylamino)-2-oxoethyl] 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate (PubChem CID 55420502) has the molecular formula C16H20F3N3O6S and a molecular weight of 439.41 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55420502 |
| Molecular Formula | C16H20F3N3O6S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3N3O6S/c1-2-3-7-20-15(25)22-13(23)10-28-14(24)9-21-29(26,27)12-6-4-5-11(8-12)16(17,18)19/h4-6,8,21H,2-3,7,9-10H2,1H3,(H2,20,22,23,25) |
| InChIKey | AHQKJALPFIPYFF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|