C21H24F3NO5S — CID 30476272
[2-(1-adamantyl)-2-oxoethyl] 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate (PubChem CID 30476272) has the molecular formula C21H24F3NO5S and a molecular weight of 459.49 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 30476272 |
| Molecular Formula | C21H24F3NO5S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1cccc(C(F)(F)F)c1)OCC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H24F3NO5S/c22-21(23,24)16-2-1-3-17(7-16)31(28,29)25-11-19(27)30-12-18(26)20-8-13-4-14(9-20)6-15(5-13)10-20/h1-3,7,13-15,25H,4-6,8-12H2 |
| InChIKey | FDCHOKNGEQCTCR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |