C17H15F3N2O5S — CID 55641591
(3-carbamoylphenyl)methyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate (PubChem CID 55641591) has the molecular formula C17H15F3N2O5S and a molecular weight of 416.38 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate.
| Compound Name | (3-carbamoylphenyl)methyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55641591 |
| Molecular Formula | C17H15F3N2O5S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (3-carbamoylphenyl)methyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
| SMILES | NC(=O)c1cccc(COC(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H15F3N2O5S/c18-17(19,20)13-5-2-6-14(8-13)28(25,26)22-9-15(23)27-10-11-3-1-4-12(7-11)16(21)24/h1-8,22H,9-10H2,(H2,21,24) |
| InChIKey | MXAZOMNUMCBCFK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |