C16H15BrClNO4S — CID 42982279
(4-bromophenyl)methyl 3-[(3-chlorophenyl)sulfonylamino]propanoate (PubChem CID 42982279) has the molecular formula C16H15BrClNO4S and a molecular weight of 432.72 g/mol. Its IUPAC name is (4-bromophenyl)methyl 3-[(3-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | (4-bromophenyl)methyl 3-[(3-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 42982279 |
| Molecular Formula | C16H15BrClNO4S |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | (4-bromophenyl)methyl 3-[(3-chlorophenyl)sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1cccc(Cl)c1)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrClNO4S/c17-13-6-4-12(5-7-13)11-23-16(20)8-9-19-24(21,22)15-3-1-2-14(18)10-15/h1-7,10,19H,8-9,11H2 |
| InChIKey | OPEYVPXGORSYCF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |