C15H12BrCl2NO4S — CID 1218601
(4-bromophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate (PubChem CID 1218601) has the molecular formula C15H12BrCl2NO4S and a molecular weight of 453.14 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate.
| Compound Name | (4-bromophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 1218601 |
| Molecular Formula | C15H12BrCl2NO4S |
| Molecular Weight | 453.14 g/mol |
| Exact Mass | 450.90 |
| IUPAC Name | (4-bromophenyl)methyl 2-[(3,4-dichlorophenyl)sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Cl)c(Cl)c1)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrCl2NO4S/c16-11-3-1-10(2-4-11)9-23-15(20)8-19-24(21,22)12-5-6-13(17)14(18)7-12/h1-7,19H,8-9H2 |
| InChIKey | CDXPVXMZKPTTMX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.14 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |