C20H16FN3O3S — CID 135846304
[(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 135846304) has the molecular formula C20H16FN3O3S and a molecular weight of 397.43 g/mol. Its IUPAC name is [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 135846304 |
| Molecular Formula | C20H16FN3O3S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | C[C@H](OC(=O)CSc1ccccc1F)/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H16FN3O3S/c1-12(27-18(25)11-28-17-9-5-2-6-14(17)21)19(26)13(10-22)20-23-15-7-3-4-8-16(15)24-20/h2-9,12,26H,11H2,1H3,(H,23,24)/b19-13-/t12-/m0/s1 |
| InChIKey | OZPFMHSCQXJHNI-XLCLWTIASA-N |
| XLogP | 4.22 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|