C22H17N5O4 — CID 135841296
[(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(4-oxoquinazolin-3-yl)acetate (PubChem CID 135841296) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(4-oxoquinazolin-3-yl)acetate.
| Compound Name | [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(4-oxoquinazolin-3-yl)acetate |
|---|---|
| PubChem CID | 135841296 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(4-oxoquinazolin-3-yl)acetate |
| SMILES | C[C@@H](OC(=O)Cn1cnc2ccccc2c1=O)/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H17N5O4/c1-13(20(29)15(10-23)21-25-17-8-4-5-9-18(17)26-21)31-19(28)11-27-12-24-16-7-3-2-6-14(16)22(27)30/h2-9,12-13,29H,11H2,1H3,(H,25,26)/b20-15-/t13-/m1/s1 |
| InChIKey | PFRGMIWMSNLWHF-LKCUONQHSA-N |
| XLogP | 2.70 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|