C19H13F2N3O3 — CID 135836633
[(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 3,5-difluorobenzoate (PubChem CID 135836633) has the molecular formula C19H13F2N3O3 and a molecular weight of 369.33 g/mol. Its IUPAC name is [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 3,5-difluorobenzoate.
| Compound Name | [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 3,5-difluorobenzoate |
|---|---|
| PubChem CID | 135836633 |
| Molecular Formula | C19H13F2N3O3 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | [(Z,2R)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 3,5-difluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(F)cc(F)c1)/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H13F2N3O3/c1-10(27-19(26)11-6-12(20)8-13(21)7-11)17(25)14(9-22)18-23-15-4-2-3-5-16(15)24-18/h2-8,10,25H,1H3,(H,23,24)/b17-14-/t10-/m1/s1 |
| InChIKey | ABAVXLKKSNCOBN-BXWLNTHASA-N |
| XLogP | 3.88 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|