C23H19N5O3 — CID 135815772
[(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 4-(5-methylpyrazol-1-yl)benzoate (PubChem CID 135815772) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 4-(5-methylpyrazol-1-yl)benzoate.
| Compound Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 4-(5-methylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 135815772 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 4-(5-methylpyrazol-1-yl)benzoate |
| SMILES | Cc1ccnn1-c1ccc(C(=O)O[C@@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H19N5O3/c1-14-11-12-25-28(14)17-9-7-16(8-10-17)23(30)31-15(2)21(29)18(13-24)22-26-19-5-3-4-6-20(19)27-22/h3-12,15,29H,1-2H3,(H,26,27)/b21-18-/t15-/m0/s1 |
| InChIKey | ZRCFRWHLUCSQDI-BAOKRACBSA-N |
| XLogP | 4.10 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|