C20H16N4O5 — CID 135702715
[(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 4-methyl-3-nitrobenzoate (PubChem CID 135702715) has the molecular formula C20H16N4O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 4-methyl-3-nitrobenzoate.
| Compound Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 135702715 |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16N4O5/c1-11-7-8-13(9-17(11)24(27)28)20(26)29-12(2)18(25)14(10-21)19-22-15-5-3-4-6-16(15)23-19/h3-9,12,25H,1-2H3,(H,22,23)/b18-14-/t12-/m0/s1 |
| InChIKey | CNFFUXNPTOWDLQ-XHAIIGHRSA-N |
| XLogP | 3.82 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|