C24H25N5O2 — CID 135779747
(Z,4S)-4-[4-(4-acetylphenyl)piperazin-1-yl]-2-(1H-benzimidazol-2-yl)-3-hydroxypent-2-enenitrile (PubChem CID 135779747) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is (Z,4S)-4-[4-(4-acetylphenyl)piperazin-1-yl]-2-(1H-benzimidazol-2-yl)-3-hydroxypent-2-enenitrile.
| Compound Name | (Z,4S)-4-[4-(4-acetylphenyl)piperazin-1-yl]-2-(1H-benzimidazol-2-yl)-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135779747 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (Z,4S)-4-[4-(4-acetylphenyl)piperazin-1-yl]-2-(1H-benzimidazol-2-yl)-3-hydroxypent-2-enenitrile |
| SMILES | CC(=O)c1ccc(N2CCN([C@@H](C)/C(O)=C(\C#N)c3nc4ccccc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c1-16(23(31)20(15-25)24-26-21-5-3-4-6-22(21)27-24)28-11-13-29(14-12-28)19-9-7-18(8-10-19)17(2)30/h3-10,16,31H,11-14H2,1-2H3,(H,26,27)/b23-20-/t16-/m0/s1 |
| InChIKey | JFKSCDSDHZYRRI-YZNZPZSRSA-N |
| XLogP | 3.77 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|